C11H12Cl2N6O — CID 80916635
4-(2,3-dichlorophenoxy)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine (PubChem CID 80916635) has the molecular formula C11H12Cl2N6O and a molecular weight of 315.16 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3-dichlorophenoxy)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80916635 |
| Molecular Formula | C11H12Cl2N6O |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-6-hydrazinyl-N,N-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(Oc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H12Cl2N6O/c1-19(2)10-15-9(18-14)16-11(17-10)20-7-5-3-4-6(12)8(7)13/h3-5H,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | ZGYQNDGMKNAVHD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|