C9H18N6O2 — CID 80918089
2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methylbutan-1-ol (PubChem CID 80918089) has the molecular formula C9H18N6O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methylbutan-1-ol.
| Compound Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 80918089 |
| Molecular Formula | C9H18N6O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)Nc1nc(NN)nc(OC)n1 |
| InChI | InChI=1S/C9H18N6O2/c1-4-9(2,5-16)14-6-11-7(15-10)13-8(12-6)17-3/h16H,4-5,10H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | UHZAJROMDZEQHN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|