C12H13N7O — CID 80919030
4-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-methylamino]benzonitrile (PubChem CID 80919030) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-methylamino]benzonitrile.
| Compound Name | 4-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-methylamino]benzonitrile |
|---|---|
| PubChem CID | 80919030 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)-methylamino]benzonitrile |
| SMILES | COc1nc(NN)nc(N(C)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C12H13N7O/c1-19(9-5-3-8(7-13)4-6-9)11-15-10(18-14)16-12(17-11)20-2/h3-6H,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | QFICJAYVFYPVCB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|