C8H17N7O2 — CID 80921975
3-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]propane-1,2-diol (PubChem CID 80921975) has the molecular formula C8H17N7O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 80921975 |
| Molecular Formula | C8H17N7O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-[[4-(dimethylamino)-6-hydrazinyl-1,3,5-triazin-2-yl]amino]propane-1,2-diol |
| SMILES | CN(C)c1nc(NN)nc(NCC(O)CO)n1 |
| InChI | InChI=1S/C8H17N7O2/c1-15(2)8-12-6(10-3-5(17)4-16)11-7(13-8)14-9/h5,16-17H,3-4,9H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | ILDRUJNOVQPWKL-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|