C12H21N5 — CID 80922901
2-hydrazinyl-5-methyl-N-(2,2,3,3-tetramethylcyclopropyl)pyrimidin-4-amine (PubChem CID 80922901) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-hydrazinyl-5-methyl-N-(2,2,3,3-tetramethylcyclopropyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-5-methyl-N-(2,2,3,3-tetramethylcyclopropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80922901 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 2-hydrazinyl-5-methyl-N-(2,2,3,3-tetramethylcyclopropyl)pyrimidin-4-amine |
| SMILES | Cc1cnc(NN)nc1NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H21N5/c1-7-6-14-10(17-13)16-8(7)15-9-11(2,3)12(9,4)5/h6,9H,13H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | RIYFGETXPGHDNG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|