C11H19N5 — CID 80924360
N-(2-cyclopropylethyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine (PubChem CID 80924360) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-cyclopropylethyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80924360 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(2-cyclopropylethyl)-5-ethyl-6-hydrazinylpyrimidin-4-amine |
| SMILES | CCc1c(NN)ncnc1NCCC1CC1 |
| InChI | InChI=1S/C11H19N5/c1-2-9-10(13-6-5-8-3-4-8)14-7-15-11(9)16-12/h7-8H,2-6,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | LRCBYHLLZMMNEC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|