C11H18F3N7 — CID 80925537
4-hydrazinyl-N,N-dimethyl-6-[4-(trifluoromethyl)piperidin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 80925537) has the molecular formula C11H18F3N7 and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-hydrazinyl-N,N-dimethyl-6-[4-(trifluoromethyl)piperidin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N,N-dimethyl-6-[4-(trifluoromethyl)piperidin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80925537 |
| Molecular Formula | C11H18F3N7 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-hydrazinyl-N,N-dimethyl-6-[4-(trifluoromethyl)piperidin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(NN)nc(N2CCC(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C11H18F3N7/c1-20(2)9-16-8(19-15)17-10(18-9)21-5-3-7(4-6-21)11(12,13)14/h7H,3-6,15H2,1-2H3,(H,16,17,18,19) |
| InChIKey | QEQOLWVFJVATMV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|