C12H13N7O — CID 80927875
3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]benzonitrile (PubChem CID 80927875) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]benzonitrile.
| Compound Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 80927875 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[(4-ethoxy-6-hydrazinyl-1,3,5-triazin-2-yl)amino]benzonitrile |
| SMILES | CCOc1nc(NN)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C12H13N7O/c1-2-20-12-17-10(16-11(18-12)19-14)15-9-5-3-4-8(6-9)7-13/h3-6H,2,14H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | YPAFXPUIDHQLFT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|