C10H10ClN5 — CID 80928115
N-(2-chlorophenyl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 80928115) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-chlorophenyl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80928115 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1nccc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H10ClN5/c11-7-3-1-2-4-8(7)14-9-5-6-13-10(15-9)16-12/h1-6H,12H2,(H2,13,14,15,16) |
| InChIKey | AEUDNWGWRFBWJZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|