C11H21N7 — CID 80928465
N,N-diethyl-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80928465) has the molecular formula C11H21N7 and a molecular weight of 251.34 g/mol. Its IUPAC name is N,N-diethyl-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N,N-diethyl-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80928465 |
| Molecular Formula | C11H21N7 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N,N-diethyl-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C11H21N7/c1-3-17(4-2)10-13-9(16-12)14-11(15-10)18-7-5-6-8-18/h3-8,12H2,1-2H3,(H,13,14,15,16) |
| InChIKey | UJPTVALDGCZDKM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|