About [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine
[6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine (PubChem CID 80930360) has the molecular formula C13H22N4
and a molecular weight of 234.35 g/mol. Its IUPAC name is [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine |
| PubChem CID | 80930360 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine |
| SMILES | CC1(C)CCCN(c2cccc(NN)n2)CC1 |
| InChI | InChI=1S/C13H22N4/c1-13(2)7-4-9-17(10-8-13)12-6-3-5-11(15-12)16-14/h3,5-6H,4,7-10,14H2,1-2H3,(H,15,16) |
| InChIKey | YWKQCLAQSYPTNI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine?
The IUPAC name of [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine (CID 80930360) is [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine?
The canonical SMILES for [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine is CC1(C)CCCN(c2cccc(NN)n2)CC1.
What is the InChIKey of [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine?
The InChIKey is YWKQCLAQSYPTNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4/c1-13(2)7-4-9-17(10-8-13)12-6-3-5-11(15-12)16-14/h3,5-6H,4,7-10,14H2,1-2H3,(H,15,16).
What are the key properties of [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine?
[6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine has a molecular weight of 234.35 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4,4-dimethylazepan-1-yl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 80930360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).