C11H12N4O2 — CID 80931261
[3-(6-hydrazinylpyrimidin-4-yl)oxyphenyl]methanol (PubChem CID 80931261) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is [3-(6-hydrazinylpyrimidin-4-yl)oxyphenyl]methanol.
| Compound Name | [3-(6-hydrazinylpyrimidin-4-yl)oxyphenyl]methanol |
|---|---|
| PubChem CID | 80931261 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | [3-(6-hydrazinylpyrimidin-4-yl)oxyphenyl]methanol |
| SMILES | NNc1cc(Oc2cccc(CO)c2)ncn1 |
| InChI | InChI=1S/C11H12N4O2/c12-15-10-5-11(14-7-13-10)17-9-3-1-2-8(4-9)6-16/h1-5,7,16H,6,12H2,(H,13,14,15) |
| InChIKey | ZPLMWYPLZIDCRQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|