C8H15N5 — CID 80932371
6-hydrazinyl-N-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 80932371) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80932371 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-hydrazinyl-N-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | CC(C)CNc1cc(NN)ncn1 |
| InChI | InChI=1S/C8H15N5/c1-6(2)4-10-7-3-8(13-9)12-5-11-7/h3,5-6H,4,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | LJYQQSNKOKDSAL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|