C12H20N6O2 — CID 80934481
2-[(2-amino-2-oxoethyl)-[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]acetamide (PubChem CID 80934481) has the molecular formula C12H20N6O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 80934481 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]acetamide |
| SMILES | CCNc1cc(N(CC(N)=O)CC(N)=O)nc(CC)n1 |
| InChI | InChI=1S/C12H20N6O2/c1-3-10-16-11(15-4-2)5-12(17-10)18(6-8(13)19)7-9(14)20/h5H,3-4,6-7H2,1-2H3,(H2,13,19)(H2,14,20)(H,15,16,17) |
| InChIKey | ZPHKCKGKVHDRIS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |