About 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine
4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine (PubChem CID 80936131) has the molecular formula C12H9Cl3N2
and a molecular weight of 287.58 g/mol. Its IUPAC name is 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine |
| PubChem CID | 80936131 |
| Molecular Formula | C12H9Cl3N2 |
| Molecular Weight | 287.58 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine |
| SMILES | CCc1nc(Cl)cc(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H9Cl3N2/c1-2-11-16-9(6-10(14)17-11)7-4-3-5-8(13)12(7)15/h3-6H,2H2,1H3 |
| InChIKey | NAAHHHZSJNCUIT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine?
The IUPAC name of 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine (CID 80936131) is 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine.
What is the SMILES notation for 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine?
The canonical SMILES for 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine is CCc1nc(Cl)cc(-c2cccc(Cl)c2Cl)n1.
What is the InChIKey of 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine?
The InChIKey is NAAHHHZSJNCUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl3N2/c1-2-11-16-9(6-10(14)17-11)7-4-3-5-8(13)12(7)15/h3-6H,2H2,1H3.
What are the key properties of 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine?
4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine has a molecular weight of 287.58 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(2,3-dichlorophenyl)-2-ethylpyrimidine is sourced from PubChem (CID 80936131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).