C14H18N4O — CID 80937644
N,2-diethyl-6-[(2-methyl-3-pyridinyl)oxy]pyrimidin-4-amine (PubChem CID 80937644) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N,2-diethyl-6-[(2-methyl-3-pyridinyl)oxy]pyrimidin-4-amine.
| Compound Name | N,2-diethyl-6-[(2-methyl-3-pyridinyl)oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80937644 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N,2-diethyl-6-[(2-methyl-3-pyridinyl)oxy]pyrimidin-4-amine |
| SMILES | CCNc1cc(Oc2cccnc2C)nc(CC)n1 |
| InChI | InChI=1S/C14H18N4O/c1-4-12-17-13(15-5-2)9-14(18-12)19-11-7-6-8-16-10(11)3/h6-9H,4-5H2,1-3H3,(H,15,17,18) |
| InChIKey | XVXSZJNXNFZNST-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |