C15H25N3O — CID 80941322
2-ethyl-6-(3,3,5-trimethylcyclohexyl)oxypyrimidin-4-amine (PubChem CID 80941322) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-ethyl-6-(3,3,5-trimethylcyclohexyl)oxypyrimidin-4-amine.
| Compound Name | 2-ethyl-6-(3,3,5-trimethylcyclohexyl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 80941322 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-ethyl-6-(3,3,5-trimethylcyclohexyl)oxypyrimidin-4-amine |
| SMILES | CCc1nc(N)cc(OC2CC(C)CC(C)(C)C2)n1 |
| InChI | InChI=1S/C15H25N3O/c1-5-13-17-12(16)7-14(18-13)19-11-6-10(2)8-15(3,4)9-11/h7,10-11H,5-6,8-9H2,1-4H3,(H2,16,17,18) |
| InChIKey | GTUIEGQHTKKODY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |