C14H17N3O2 — CID 80941964
2-ethyl-6-[3-(methoxymethyl)phenoxy]pyrimidin-4-amine (PubChem CID 80941964) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-ethyl-6-[3-(methoxymethyl)phenoxy]pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-[3-(methoxymethyl)phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80941964 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-ethyl-6-[3-(methoxymethyl)phenoxy]pyrimidin-4-amine |
| SMILES | CCc1nc(N)cc(Oc2cccc(COC)c2)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-3-13-16-12(15)8-14(17-13)19-11-6-4-5-10(7-11)9-18-2/h4-8H,3,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | IMCNPZILIAVMPB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |