About 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine
2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine (PubChem CID 80942433) has the molecular formula C11H16F3N3O
and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
| PubChem CID | 80942433 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine |
| SMILES | CCCNc1cc(OCC(F)(F)F)nc(CC)n1 |
| InChI | InChI=1S/C11H16F3N3O/c1-3-5-15-9-6-10(17-8(4-2)16-9)18-7-11(12,13)14/h6H,3-5,7H2,1-2H3,(H,15,16,17) |
| InChIKey | QTBLIOYLOHBUHQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine?
The IUPAC name of 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine (CID 80942433) is 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine.
What is the SMILES notation for 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine?
The canonical SMILES for 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine is CCCNc1cc(OCC(F)(F)F)nc(CC)n1.
What is the InChIKey of 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine?
The InChIKey is QTBLIOYLOHBUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O/c1-3-5-15-9-6-10(17-8(4-2)16-9)18-7-11(12,13)14/h6H,3-5,7H2,1-2H3,(H,15,16,17).
What are the key properties of 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine?
2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine has a molecular weight of 263.26 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-propyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-amine is sourced from PubChem (CID 80942433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).