C12H16F5N3O — CID 80942656
N-ethyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propylpyrimidin-4-amine (PubChem CID 80942656) has the molecular formula C12H16F5N3O and a molecular weight of 313.27 g/mol. Its IUPAC name is N-ethyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80942656 |
| Molecular Formula | C12H16F5N3O |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-ethyl-6-(2,2,3,3,3-pentafluoropropoxy)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NCC)cc(OCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H16F5N3O/c1-3-5-8-19-9(18-4-2)6-10(20-8)21-7-11(13,14)12(15,16)17/h6H,3-5,7H2,1-2H3,(H,18,19,20) |
| InChIKey | VMYLXYKAFYNHSO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|