C11H18ClN3 — CID 80944320
6-chloro-2-ethyl-N-pentan-3-ylpyrimidin-4-amine (PubChem CID 80944320) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-pentan-3-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-N-pentan-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80944320 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-chloro-2-ethyl-N-pentan-3-ylpyrimidin-4-amine |
| SMILES | CCc1nc(Cl)cc(NC(CC)CC)n1 |
| InChI | InChI=1S/C11H18ClN3/c1-4-8(5-2)13-11-7-9(12)14-10(6-3)15-11/h7-8H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | FVGPNAJVGNHOAU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |