C15H26ClN3O2 — CID 80945315
2-tert-butyl-6-chloro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)pyrimidin-4-amine (PubChem CID 80945315) has the molecular formula C15H26ClN3O2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-chloro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80945315 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)pyrimidin-4-amine |
| SMILES | COCCN(c1cc(Cl)nc(C(C)(C)C)n1)C(C)COC |
| InChI | InChI=1S/C15H26ClN3O2/c1-11(10-21-6)19(7-8-20-5)13-9-12(16)17-14(18-13)15(2,3)4/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | DYEURMORDYECBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |