C14H19ClN4 — CID 80945789
4-chloro-2-propyl-6-[(1-propylimidazol-2-yl)methyl]pyrimidine (PubChem CID 80945789) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 4-chloro-2-propyl-6-[(1-propylimidazol-2-yl)methyl]pyrimidine.
| Compound Name | 4-chloro-2-propyl-6-[(1-propylimidazol-2-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 80945789 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-chloro-2-propyl-6-[(1-propylimidazol-2-yl)methyl]pyrimidine |
| SMILES | CCCc1nc(Cl)cc(Cc2nccn2CCC)n1 |
| InChI | InChI=1S/C14H19ClN4/c1-3-5-13-17-11(9-12(15)18-13)10-14-16-6-8-19(14)7-4-2/h6,8-9H,3-5,7,10H2,1-2H3 |
| InChIKey | KMNYFRVEHKTNDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |