C14H23N5 — CID 80945818
3-[methyl-[2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanenitrile (PubChem CID 80945818) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[methyl-[2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[methyl-[2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 80945818 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 3-[methyl-[2-propyl-6-(propylamino)pyrimidin-4-yl]amino]propanenitrile |
| SMILES | CCCNc1cc(N(C)CCC#N)nc(CCC)n1 |
| InChI | InChI=1S/C14H23N5/c1-4-7-12-17-13(16-9-5-2)11-14(18-12)19(3)10-6-8-15/h11H,4-7,9-10H2,1-3H3,(H,16,17,18) |
| InChIKey | WKBBIVRLYUPYNF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |