C14H14F3N3 — CID 80946552
N-methyl-2-propyl-6-(3,4,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 80946552) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is N-methyl-2-propyl-6-(3,4,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | N-methyl-2-propyl-6-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80946552 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-methyl-2-propyl-6-(3,4,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | CCCc1nc(NC)cc(-c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H14F3N3/c1-3-4-12-19-11(7-13(18-2)20-12)8-5-9(15)14(17)10(16)6-8/h5-7H,3-4H2,1-2H3,(H,18,19,20) |
| InChIKey | QPOBGCLHVFXBBV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|