C14H26N6 — CID 80946979
1-(6-hydrazinyl-2-propylpyrimidin-4-yl)-N,N-dimethylpiperidin-3-amine (PubChem CID 80946979) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(6-hydrazinyl-2-propylpyrimidin-4-yl)-N,N-dimethylpiperidin-3-amine.
| Compound Name | 1-(6-hydrazinyl-2-propylpyrimidin-4-yl)-N,N-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 80946979 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-(6-hydrazinyl-2-propylpyrimidin-4-yl)-N,N-dimethylpiperidin-3-amine |
| SMILES | CCCc1nc(NN)cc(N2CCCC(N(C)C)C2)n1 |
| InChI | InChI=1S/C14H26N6/c1-4-6-12-16-13(18-15)9-14(17-12)20-8-5-7-11(10-20)19(2)3/h9,11H,4-8,10,15H2,1-3H3,(H,16,17,18) |
| InChIKey | MXGSWANTXJYELB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|