C11H18F3N5O — CID 80947072
6-hydrazinyl-2-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine (PubChem CID 80947072) has the molecular formula C11H18F3N5O and a molecular weight of 293.29 g/mol. Its IUPAC name is 6-hydrazinyl-2-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80947072 |
| Molecular Formula | C11H18F3N5O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 6-hydrazinyl-2-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H18F3N5O/c1-2-3-8-17-9(6-10(18-8)19-15)16-4-5-20-7-11(12,13)14/h6H,2-5,7,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | CAALQDAKNMSEMB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|