C17H32N4 — CID 80949421
4-N,4-N-dibutyl-6-N-ethyl-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 80949421) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-N,4-N-dibutyl-6-N-ethyl-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibutyl-6-N-ethyl-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80949421 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 4-N,4-N-dibutyl-6-N-ethyl-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CCCCN(CCCC)c1cc(NCC)nc(C(C)C)n1 |
| InChI | InChI=1S/C17H32N4/c1-6-9-11-21(12-10-7-2)16-13-15(18-8-3)19-17(20-16)14(4)5/h13-14H,6-12H2,1-5H3,(H,18,19,20) |
| InChIKey | CKQHPQFPWKQCKY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |