C10H11ClF4N2O — CID 80949502
4-chloro-2-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine (PubChem CID 80949502) has the molecular formula C10H11ClF4N2O and a molecular weight of 286.66 g/mol. Its IUPAC name is 4-chloro-2-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine.
| Compound Name | 4-chloro-2-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine |
|---|---|
| PubChem CID | 80949502 |
| Molecular Formula | C10H11ClF4N2O |
| Molecular Weight | 286.66 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-chloro-2-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidine |
| SMILES | CC(C)c1nc(Cl)cc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H11ClF4N2O/c1-5(2)8-16-6(11)3-7(17-8)18-4-10(14,15)9(12)13/h3,5,9H,4H2,1-2H3 |
| InChIKey | WDQKRVWZYULFTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|