About 2-ethoxyethyl acetate
2-ethoxyethyl acetate (PubChem CID 8095) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-ethoxyethyl acetate.
Molecular Properties
| Compound Name | 2-ethoxyethyl acetate |
| PubChem CID | 8095 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 2-ethoxyethyl acetate |
| SMILES | CCOCCOC(C)=O |
| InChI | InChI=1S/C6H12O3/c1-3-8-4-5-9-6(2)7/h3-5H2,1-2H3 |
| InChIKey | SVONRAPFKPVNKG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl acetate?
The IUPAC name of 2-ethoxyethyl acetate (CID 8095) is 2-ethoxyethyl acetate.
What is the SMILES notation for 2-ethoxyethyl acetate?
The canonical SMILES for 2-ethoxyethyl acetate is CCOCCOC(C)=O.
What is the InChIKey of 2-ethoxyethyl acetate?
The InChIKey is SVONRAPFKPVNKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-3-8-4-5-9-6(2)7/h3-5H2,1-2H3.
What are the key properties of 2-ethoxyethyl acetate?
2-ethoxyethyl acetate has a molecular weight of 132.16 g/mol, XLogP of 0.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl acetate is sourced from PubChem (CID 8095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).