C13H22ClN3O — CID 80951387
1-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)-ethylamino]-2-methylpropan-2-ol (PubChem CID 80951387) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80951387 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-[(6-chloro-2-propan-2-ylpyrimidin-4-yl)-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)c1cc(Cl)nc(C(C)C)n1 |
| InChI | InChI=1S/C13H22ClN3O/c1-6-17(8-13(4,5)18)11-7-10(14)15-12(16-11)9(2)3/h7,9,18H,6,8H2,1-5H3 |
| InChIKey | HRWKGDHXNUQDGC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |