C11H14N6 — CID 80956167
2-[(6-amino-2-propan-2-ylpyrimidin-4-yl)-(cyanomethyl)amino]acetonitrile (PubChem CID 80956167) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-[(6-amino-2-propan-2-ylpyrimidin-4-yl)-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[(6-amino-2-propan-2-ylpyrimidin-4-yl)-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 80956167 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[(6-amino-2-propan-2-ylpyrimidin-4-yl)-(cyanomethyl)amino]acetonitrile |
| SMILES | CC(C)c1nc(N)cc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C11H14N6/c1-8(2)11-15-9(14)7-10(16-11)17(5-3-12)6-4-13/h7-8H,5-6H2,1-2H3,(H2,14,15,16) |
| InChIKey | FKRJTKCGAJDTMR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|