C13H13IN4 — CID 80956491
2-cyclopropyl-4-N-(2-iodophenyl)pyrimidine-4,6-diamine (PubChem CID 80956491) has the molecular formula C13H13IN4 and a molecular weight of 352.18 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-(2-iodophenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-cyclopropyl-4-N-(2-iodophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80956491 |
| Molecular Formula | C13H13IN4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-cyclopropyl-4-N-(2-iodophenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(Nc2ccccc2I)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H13IN4/c14-9-3-1-2-4-10(9)16-12-7-11(15)17-13(18-12)8-5-6-8/h1-4,7-8H,5-6H2,(H3,15,16,17,18) |
| InChIKey | KCSQQUDYSIZTPO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|