C15H23N5O — CID 80956690
1-[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 80956690) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 80956690 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[2-cyclopropyl-6-(ethylamino)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | CCNc1cc(N2CCC(C(N)=O)CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C15H23N5O/c1-2-17-12-9-13(19-15(18-12)11-3-4-11)20-7-5-10(6-8-20)14(16)21/h9-11H,2-8H2,1H3,(H2,16,21)(H,17,18,19) |
| InChIKey | MPDSXLCCVFJZIJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |