C17H19N3O — CID 80957766
2-cyclopropyl-N-methyl-6-[2-[(E)-prop-1-enyl]phenoxy]pyrimidin-4-amine (PubChem CID 80957766) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-cyclopropyl-N-methyl-6-[2-[(E)-prop-1-enyl]phenoxy]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-methyl-6-[2-[(E)-prop-1-enyl]phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80957766 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-cyclopropyl-N-methyl-6-[2-[(E)-prop-1-enyl]phenoxy]pyrimidin-4-amine |
| SMILES | C/C=C/c1ccccc1Oc1cc(NC)nc(C2CC2)n1 |
| InChI | InChI=1S/C17H19N3O/c1-3-6-12-7-4-5-8-14(12)21-16-11-15(18-2)19-17(20-16)13-9-10-13/h3-8,11,13H,9-10H2,1-2H3,(H,18,19,20)/b6-3+ |
| InChIKey | JADGLNVUGHQYFC-ZZXKWVIFSA-N |
| XLogP | 4.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |