C15H26N4 — CID 80961252
4-N-(4-ethylcyclohexyl)-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 80961252) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-N-(4-ethylcyclohexyl)-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-ethylcyclohexyl)-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80961252 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 4-N-(4-ethylcyclohexyl)-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CCC1CCC(Nc2cc(N)nc(C(C)C)n2)CC1 |
| InChI | InChI=1S/C15H26N4/c1-4-11-5-7-12(8-6-11)17-14-9-13(16)18-15(19-14)10(2)3/h9-12H,4-8H2,1-3H3,(H3,16,17,18,19) |
| InChIKey | ANJPTHRJODHRRV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |