C15H27N5O — CID 80961589
2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-ethylamino]-N-ethylacetamide (PubChem CID 80961589) has the molecular formula C15H27N5O and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 80961589 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1cc(NC)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H27N5O/c1-7-17-13(21)10-20(8-2)12-9-11(16-6)18-14(19-12)15(3,4)5/h9H,7-8,10H2,1-6H3,(H,17,21)(H,16,18,19) |
| InChIKey | FRIDNJFZQKVPLY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |