About 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine
2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine (PubChem CID 80963065) has the molecular formula C13H19N5S
and a molecular weight of 277.40 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine |
| PubChem CID | 80963065 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine |
| SMILES | Cc1cc(Sc2cc(N)nc(C(C)(C)C)n2)n(C)n1 |
| InChI | InChI=1S/C13H19N5S/c1-8-6-11(18(5)17-8)19-10-7-9(14)15-12(16-10)13(2,3)4/h6-7H,1-5H3,(H2,14,15,16) |
| InChIKey | XORRBKOLOORTIR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine?
The IUPAC name of 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine (CID 80963065) is 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine.
What is the SMILES notation for 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine?
The canonical SMILES for 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine is Cc1cc(Sc2cc(N)nc(C(C)(C)C)n2)n(C)n1.
What is the InChIKey of 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine?
The InChIKey is XORRBKOLOORTIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5S/c1-8-6-11(18(5)17-8)19-10-7-9(14)15-12(16-10)13(2,3)4/h6-7H,1-5H3,(H2,14,15,16).
What are the key properties of 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine?
2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine has a molecular weight of 277.40 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(2,5-dimethylpyrazol-3-yl)sulfanylpyrimidin-4-amine is sourced from PubChem (CID 80963065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).