C11H19N5O2S — CID 80963982
[6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80963982) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80963982 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [6-(1,1-dioxo-1,4-thiazinan-4-yl)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | CC(C)c1nc(NN)cc(N2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C11H19N5O2S/c1-8(2)11-13-9(15-12)7-10(14-11)16-3-5-19(17,18)6-4-16/h7-8H,3-6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | HMFFDERWHZCLSG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|