C13H25N5O2 — CID 80963989
6-hydrazinyl-N,N-bis(2-methoxyethyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 80963989) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-bis(2-methoxyethyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,N-bis(2-methoxyethyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80963989 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 6-hydrazinyl-N,N-bis(2-methoxyethyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | COCCN(CCOC)c1cc(NN)nc(C(C)C)n1 |
| InChI | InChI=1S/C13H25N5O2/c1-10(2)13-15-11(17-14)9-12(16-13)18(5-7-19-3)6-8-20-4/h9-10H,5-8,14H2,1-4H3,(H,15,16,17) |
| InChIKey | DHXHUAANRCXULZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|