C11H10F3N5 — CID 80965712
2-cyclopropyl-6-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine (PubChem CID 80965712) has the molecular formula C11H10F3N5 and a molecular weight of 269.23 g/mol. Its IUPAC name is 2-cyclopropyl-6-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80965712 |
| Molecular Formula | C11H10F3N5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-cyclopropyl-6-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine |
| SMILES | Nc1cc(-n2ccc(C(F)(F)F)n2)nc(C2CC2)n1 |
| InChI | InChI=1S/C11H10F3N5/c12-11(13,14)7-3-4-19(18-7)9-5-8(15)16-10(17-9)6-1-2-6/h3-6H,1-2H2,(H2,15,16,17) |
| InChIKey | RNOSRCXHELCZGA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |