C10H18N4O — CID 80966926
3-[(6-amino-2-propan-2-ylpyrimidin-4-yl)amino]propan-1-ol (PubChem CID 80966926) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-[(6-amino-2-propan-2-ylpyrimidin-4-yl)amino]propan-1-ol.
| Compound Name | 3-[(6-amino-2-propan-2-ylpyrimidin-4-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 80966926 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-[(6-amino-2-propan-2-ylpyrimidin-4-yl)amino]propan-1-ol |
| SMILES | CC(C)c1nc(N)cc(NCCCO)n1 |
| InChI | InChI=1S/C10H18N4O/c1-7(2)10-13-8(11)6-9(14-10)12-4-3-5-15/h6-7,15H,3-5H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | UJNIHKBPSDTCRY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|