C9H11F3N4O — CID 80969563
[2-cyclopropyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 80969563) has the molecular formula C9H11F3N4O and a molecular weight of 248.21 g/mol. Its IUPAC name is [2-cyclopropyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80969563 |
| Molecular Formula | C9H11F3N4O |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [2-cyclopropyl-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(OCC(F)(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C9H11F3N4O/c10-9(11,12)4-17-7-3-6(16-13)14-8(15-7)5-1-2-5/h3,5H,1-2,4,13H2,(H,14,15,16) |
| InChIKey | CXHUCCLEJLRUEP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|