About 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine
6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 80970262) has the molecular formula C14H18ClN5
and a molecular weight of 291.79 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine |
| PubChem CID | 80970262 |
| Molecular Formula | C14H18ClN5 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C14H18ClN5/c1-9-12(15)17-13(11-4-5-11)18-14(9)19(2)7-10-6-16-20(3)8-10/h6,8,11H,4-5,7H2,1-3H3 |
| InChIKey | VSMKFQRMAZORED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine?
The IUPAC name of 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine (CID 80970262) is 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine?
The canonical SMILES for 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine is Cc1c(Cl)nc(C2CC2)nc1N(C)Cc1cnn(C)c1.
What is the InChIKey of 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine?
The InChIKey is VSMKFQRMAZORED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN5/c1-9-12(15)17-13(11-4-5-11)18-14(9)19(2)7-10-6-16-20(3)8-10/h6,8,11H,4-5,7H2,1-3H3.
What are the key properties of 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine?
6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine has a molecular weight of 291.79 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-cyclopropyl-N,5-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 80970262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).