C13H18ClN3O — CID 80970322
6-chloro-2-cyclopropyl-5-methyl-N-(oxolan-2-ylmethyl)pyrimidin-4-amine (PubChem CID 80970322) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-5-methyl-N-(oxolan-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-5-methyl-N-(oxolan-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80970322 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-chloro-2-cyclopropyl-5-methyl-N-(oxolan-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NCC1CCCO1 |
| InChI | InChI=1S/C13H18ClN3O/c1-8-11(14)16-13(9-4-5-9)17-12(8)15-7-10-3-2-6-18-10/h9-10H,2-7H2,1H3,(H,15,16,17) |
| InChIKey | KKBDXTWMZYPTBS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |