C14H18ClN5S — CID 80970501
3-(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)sulfanyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 80970501) has the molecular formula C14H18ClN5S and a molecular weight of 323.85 g/mol. Its IUPAC name is 3-(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)sulfanyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)sulfanyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 80970501 |
| Molecular Formula | C14H18ClN5S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-(6-chloro-2-ethyl-5-methylpyrimidin-4-yl)sulfanyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | CCc1nc(Cl)c(C)c(Sc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C14H18ClN5S/c1-3-10-16-12(15)9(2)13(17-10)21-14-19-18-11-7-5-4-6-8-20(11)14/h3-8H2,1-2H3 |
| InChIKey | PWFBGBZPLWRWTH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |