C15H17ClN2O — CID 80973005
4-chloro-6-(3,5-dimethylphenoxy)-2-ethyl-5-methylpyrimidine (PubChem CID 80973005) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 4-chloro-6-(3,5-dimethylphenoxy)-2-ethyl-5-methylpyrimidine.
| Compound Name | 4-chloro-6-(3,5-dimethylphenoxy)-2-ethyl-5-methylpyrimidine |
|---|---|
| PubChem CID | 80973005 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-chloro-6-(3,5-dimethylphenoxy)-2-ethyl-5-methylpyrimidine |
| SMILES | CCc1nc(Cl)c(C)c(Oc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C15H17ClN2O/c1-5-13-17-14(16)11(4)15(18-13)19-12-7-9(2)6-10(3)8-12/h6-8H,5H2,1-4H3 |
| InChIKey | KEPJONTYTFFEQQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |