C12H15ClN4 — CID 80973034
3-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)-methylamino]propanenitrile (PubChem CID 80973034) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)-methylamino]propanenitrile.
| Compound Name | 3-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)-methylamino]propanenitrile |
|---|---|
| PubChem CID | 80973034 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-[(6-chloro-2-cyclopropyl-5-methylpyrimidin-4-yl)-methylamino]propanenitrile |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1N(C)CCC#N |
| InChI | InChI=1S/C12H15ClN4/c1-8-10(13)15-11(9-4-5-9)16-12(8)17(2)7-3-6-14/h9H,3-5,7H2,1-2H3 |
| InChIKey | YESLCTJHOPZYGO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |