C16H20FN3 — CID 80975172
2-ethyl-6-(2-fluorophenyl)-5-methyl-N-propylpyrimidin-4-amine (PubChem CID 80975172) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is 2-ethyl-6-(2-fluorophenyl)-5-methyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-ethyl-6-(2-fluorophenyl)-5-methyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80975172 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-ethyl-6-(2-fluorophenyl)-5-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CC)nc(-c2ccccc2F)c1C |
| InChI | InChI=1S/C16H20FN3/c1-4-10-18-16-11(3)15(19-14(5-2)20-16)12-8-6-7-9-13(12)17/h6-9H,4-5,10H2,1-3H3,(H,18,19,20) |
| InChIKey | OPCZWDYBWXFZTG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |