C14H13Cl2N3 — CID 80975439
2-cyclopropyl-6-(3,4-dichlorophenyl)-5-methylpyrimidin-4-amine (PubChem CID 80975439) has the molecular formula C14H13Cl2N3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-cyclopropyl-6-(3,4-dichlorophenyl)-5-methylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-(3,4-dichlorophenyl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80975439 |
| Molecular Formula | C14H13Cl2N3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-cyclopropyl-6-(3,4-dichlorophenyl)-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(N)nc(C2CC2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3/c1-7-12(9-4-5-10(15)11(16)6-9)18-14(8-2-3-8)19-13(7)17/h4-6,8H,2-3H2,1H3,(H2,17,18,19) |
| InChIKey | OMVUJKBBHMYRDP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |